CAS 1263378-56-8

N,N-Dimethyl-6-(2-pyrrolidinyl)-2-pyridinamine

Description:

N,N-Dimethyl-6-(2-pyrrolidinyl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a dimethylamino group and a pyrrolidine moiety. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as basicity due to the presence of nitrogen atoms. It is likely to be a solid at room temperature, with potential solubility in polar organic solvents. The presence of the pyrrolidine ring may impart certain steric and electronic effects, influencing its reactivity and interactions with biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with exposure. As with all compounds, its behavior in various chemical environments can be influenced by factors such as pH, temperature, and the presence of other reactants.

Formula: C₁₁H₁₇N₃

InChI: InChI=1S/C11H17N3/c1-14(2)11-7-3-5-10(13-11)9-6-4-8-12-9/h3,5,7,9,12H,4,6,8H2,1-2H3

InChI key: InChIKey=RPFMPLDEJWKTMY-UHFFFAOYSA-N

SMILES: N(C)(C)C1=NC(=CC=C1)C2CCCN2

Synonyms:

• N,N-Dimethyl-6-(2-pyrrolidinyl)-2-pyridinamine
• 2-Pyridinamine, N,N-dimethyl-6-(2-pyrrolidinyl)-