
CAS 1263378-57-9
:rel-1,1-Dimethylethyl (1R,5S)-1-methyl-6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate
Description:
Rel-1,1-Dimethylethyl (1R,5S)-1-methyl-6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate, identified by its CAS number 1263378-57-9, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom within a seven-membered ring. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the dimethyl group indicates steric hindrance, which may influence its interactions with other molecules. The specific stereochemistry, denoted by the (1R,5S) configuration, suggests that the compound exhibits chirality, which can affect its biological activity and pharmacological properties. Such compounds are often of interest in medicinal chemistry due to their potential as drug candidates or intermediates in the synthesis of more complex molecules. The oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, this compound's unique structural features make it a subject of interest for further research in organic and medicinal chemistry.
Formula:C12H19NO3
InChI:InChI=1/C12H19NO3/c1-11(2,3)16-10(15)13-6-8-9(14)5-12(8,4)7-13/h8H,5-7H2,1-4H3/t8-,12-/s2
InChI key:InChIKey=ZHAYAUIMRPDSNP-XMVNHEHONA-N
SMILES:C[C@]12[C@](CN(C(OC(C)(C)C)=O)C1)(C(=O)C2)[H]
Synonyms:- 3-Azabicyclo[3.2.0]heptane-3-carboxylic acid, 1-methyl-6-oxo-, 1,1-dimethylethyl ester, (1R,5S)-rel-
- rel-1,1-Dimethylethyl (1R,5S)-1-methyl-6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.