CAS 1263378-58-0
:1-(3-Hydroxy-3-methyl-1-pyrrolidinyl)ethanone
Description:
1-(3-Hydroxy-3-methyl-1-pyrrolidinyl)ethanone, identified by its CAS number 1263378-58-0, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a hydroxyl group (-OH) that contributes to its potential reactivity and solubility in polar solvents. The presence of the ethanone functional group indicates that it has ketone characteristics, which can influence its chemical behavior, particularly in reactions involving nucleophiles. This compound may exhibit biological activity due to its structural motifs, making it of interest in medicinal chemistry and pharmacology. Its molecular properties, such as polarity, boiling point, and solubility, are influenced by the functional groups present, which can affect its interactions in biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-6(9)8-4-3-7(2,10)5-8/h10H,3-5H2,1-2H3
InChI key:InChIKey=FFUFCIJZAUZZKC-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CC(C)(O)CC1
Synonyms:- Ethanone, 1-(3-hydroxy-3-methyl-1-pyrrolidinyl)-
- 1-(3-Hydroxy-3-methyl-1-pyrrolidinyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.