CymitQuimica logo

CAS 1263378-66-0

:

7-Bromo-1,2,3,4-tetrahydro-4-quinolinol

Description:
7-Bromo-1,2,3,4-tetrahydro-4-quinolinol is a chemical compound characterized by its unique bicyclic structure, which includes a quinoline moiety. This compound features a bromine atom at the 7-position and a hydroxyl group at the 4-position of the tetrahydroquinoline framework. The presence of the bromine substituent can influence the compound's reactivity and potential biological activity, making it of interest in medicinal chemistry. The tetrahydroquinoline structure contributes to its potential as a scaffold for drug development, particularly in the context of neuropharmacology and other therapeutic areas. Additionally, the compound may exhibit properties such as solubility in organic solvents and varying stability under different conditions, which are important for its application in research and industry. Its specific interactions with biological targets and its overall pharmacological profile would require further investigation through experimental studies. Overall, 7-Bromo-1,2,3,4-tetrahydro-4-quinolinol represents a significant compound for exploration in chemical and pharmaceutical research.
Formula:C9H10BrNO
InChI:InChI=1S/C9H10BrNO/c10-6-1-2-7-8(5-6)11-4-3-9(7)12/h1-2,5,9,11-12H,3-4H2
InChI key:InChIKey=TZLRCPAGFJLVIX-UHFFFAOYSA-N
SMILES:OC1C=2C(=CC(Br)=CC2)NCC1
Synonyms:
  • 7-Bromo-1,2,3,4-tetrahydro-4-quinolinol
  • 4-Quinolinol, 7-bromo-1,2,3,4-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.