CymitQuimica logo

CAS 1263378-73-9

:

1H-Indol-6-amine, 2,3-dihydro-1-(phenylmethyl)-, hydrochloride (1:2)

Description:
1H-Indol-6-amine, 2,3-dihydro-1-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features an amine group at the 6-position of the indole and a phenylmethyl substituent, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in water and stability. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry and drug development. The presence of the indole moiety is often associated with various biological activities, including interactions with neurotransmitter systems. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility can vary based on the specific conditions and the presence of the hydrochloride salt. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C15H16N2·2ClH
InChI:InChI=1S/C15H16N2.2ClH/c16-14-7-6-13-8-9-17(15(13)10-14)11-12-4-2-1-3-5-12;;/h1-7,10H,8-9,11,16H2;2*1H
InChI key:InChIKey=RQTQFDYXJIQNNU-UHFFFAOYSA-N
SMILES:C(N1C=2C(CC1)=CC=C(N)C2)C3=CC=CC=C3.Cl
Synonyms:
  • 1H-Indol-6-amine, 2,3-dihydro-1-(phenylmethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.