CymitQuimica logo

CAS 1263378-82-0

:

3-(3,5-Difluorophenoxy)azetidine

Description:
3-(3,5-Difluorophenoxy)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 3-(3,5-difluorophenoxy) substituent indicates that the azetidine is functionalized with a phenoxy group that has two fluorine atoms positioned at the 3 and 5 positions of the aromatic ring. This substitution can significantly influence the compound's physical and chemical properties, such as its polarity, solubility, and reactivity. The fluorine atoms often enhance the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit unique interactions with biological targets due to the presence of the azetidine ring and the difluorophenoxy group. Its specific applications and behavior in various chemical environments would depend on further studies, including its synthesis, stability, and potential uses in pharmaceuticals or agrochemicals.
Formula:C9H9F2NO
InChI:InChI=1S/C9H9F2NO/c10-6-1-7(11)3-8(2-6)13-9-4-12-5-9/h1-3,9,12H,4-5H2
InChI key:InChIKey=VXXACJCOSVCADM-UHFFFAOYSA-N
SMILES:O(C1=CC(F)=CC(F)=C1)C2CNC2
Synonyms:
  • 3-(3,5-Difluorophenoxy)azetidine
  • Azetidine, 3-(3,5-difluorophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.