CymitQuimica logo

CAS 1263378-86-4

:

Isoquinoline, 7-bromo-1,2,3,4-tetrahydro-2-methyl-, hydrochloride (1:1)

Description:
Isoquinoline, 7-bromo-1,2,3,4-tetrahydro-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound derived from quinoline. The presence of the bromine atom at the 7-position and the methyl group at the 2-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring structure that may influence its pharmacological properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its CAS number, 1263378-86-4, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, this compound represents a significant class of heterocyclic compounds with potential therapeutic implications.
Formula:C10H12BrN·ClH
InChI:InChI=1S/C10H12BrN.ClH/c1-12-5-4-8-2-3-10(11)6-9(8)7-12;/h2-3,6H,4-5,7H2,1H3;1H
InChI key:InChIKey=UJYZSZGQLKWZME-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(CCN(C)C2)=CC1.Cl
Synonyms:
  • Isoquinoline, 7-bromo-1,2,3,4-tetrahydro-2-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.