CAS 1263378-93-3

1,1-Dimethylethyl N-[2-(2-pyrrolidinyl)ethyl]carbamate

Description:

1,1-Dimethylethyl N-[2-(2-pyrrolidinyl)ethyl]carbamate, identified by its CAS number 1263378-93-3, is a chemical compound that belongs to the class of carbamates. This substance features a tert-butyl group (1,1-dimethylethyl) attached to a carbamate functional group, which is linked to a 2-(2-pyrrolidinyl)ethyl moiety. The presence of the pyrrolidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological systems. The compound is likely to exhibit moderate to high lipophilicity, which can influence its bioavailability and pharmacokinetics. Additionally, the structural characteristics may impart specific reactivity patterns, making it of interest in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, including solubility, stability, and potential applications in various fields.

Formula: C₁₁H₂₂N₂O₂

InChI: InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-8-6-9-5-4-7-12-9/h9,12H,4-8H2,1-3H3,(H,13,14)

InChI key: InChIKey=UNANQGCDACTJPA-UHFFFAOYSA-N

SMILES: O(C(C)(C)C)C(NCCC1CCCN1)=O

Synonyms:

• Carbamic acid, N-[2-(2-pyrrolidinyl)ethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[2-(2-pyrrolidinyl)ethyl]carbamate