CAS 1263379-02-7

Benzenamine, 4-(3-pyrrolidinyloxy)-, hydrochloride (1:2)

Description:

Benzenamine, 4-(3-pyrrolidinyloxy)-, hydrochloride (1:2), also known by its CAS number 1263379-02-7, is a chemical compound characterized by its structure, which includes a benzenamine moiety substituted with a pyrrolidinyloxy group. This compound typically appears as a hydrochloride salt, indicating it is a protonated form that enhances its solubility in water. The presence of the pyrrolidinyloxy group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound may exhibit properties such as moderate to high polarity, which can influence its bioavailability and pharmacokinetics. Additionally, the hydrochloride form often stabilizes the compound and facilitates its handling in laboratory settings. As with many amines, it may also participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications.

Formula: C₁₀H₁₄N₂O·2ClH

InChI: InChI=1S/C10H14N2O.2ClH/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10;;/h1-4,10,12H,5-7,11H2;2*1H

InChI key: InChIKey=ZZCMFRAEMNWMIM-UHFFFAOYSA-N

SMILES: O(C1=CC=C(N)C=C1)C2CCNC2.Cl

Synonyms:

• Benzenamine, 4-(3-pyrrolidinyloxy)-, hydrochloride (1:2)