CAS 1263386-32-8

2-Quinolinecarboxylic acid, 6-chloro-4-(trifluoromethyl)-, ethyl ester

Description:

2-Quinolinecarboxylic acid, 6-chloro-4-(trifluoromethyl)-, ethyl ester is a chemical compound characterized by its quinoline structure, which features a bicyclic aromatic system. The presence of a carboxylic acid functional group indicates its potential for forming esters and participating in various chemical reactions. The chloro and trifluoromethyl substituents enhance its reactivity and influence its physical properties, such as solubility and boiling point. This compound is likely to exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its ethyl ester form suggests it may be more lipophilic, potentially affecting its absorption and distribution in biological systems. Additionally, the trifluoromethyl group is known to impart unique electronic properties, which can enhance the compound's interaction with biological targets. Overall, this compound's characteristics make it a subject of interest for further research in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₃H₉ClF₃NO₂

InChI: InChI=1S/C13H9ClF3NO2/c1-2-20-12(19)11-6-9(13(15,16)17)8-5-7(14)3-4-10(8)18-11/h3-6H,2H2,1H3

InChI key: InChIKey=MLUQDYXYTIQLLY-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C2=C(N=C(C(OCC)=O)C1)C=CC(Cl)=C2

Synonyms:

• Ethyl 6-chloro-4-(trifluoromethyl)quinoline-2-carboxylate
• 2-Quinolinecarboxylic acid, 6-chloro-4-(trifluoromethyl)-, ethyl ester