
CAS 1263386-32-8
:2-Quinolinecarboxylic acid, 6-chloro-4-(trifluoromethyl)-, ethyl ester
Description:
2-Quinolinecarboxylic acid, 6-chloro-4-(trifluoromethyl)-, ethyl ester is a chemical compound characterized by its quinoline structure, which features a bicyclic aromatic system. The presence of a carboxylic acid functional group indicates its potential for forming esters and participating in various chemical reactions. The chloro and trifluoromethyl substituents enhance its reactivity and influence its physical properties, such as solubility and boiling point. This compound is likely to exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its ethyl ester form suggests it may be more lipophilic, potentially affecting its absorption and distribution in biological systems. Additionally, the trifluoromethyl group is known to impart unique electronic properties, which can enhance the compound's interaction with biological targets. Overall, this compound's characteristics make it a subject of interest for further research in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H9ClF3NO2
InChI:InChI=1S/C13H9ClF3NO2/c1-2-20-12(19)11-6-9(13(15,16)17)8-5-7(14)3-4-10(8)18-11/h3-6H,2H2,1H3
InChI key:InChIKey=MLUQDYXYTIQLLY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N=C(C(OCC)=O)C1)C=CC(Cl)=C2
Synonyms:- Ethyl 6-chloro-4-(trifluoromethyl)quinoline-2-carboxylate
- 2-Quinolinecarboxylic acid, 6-chloro-4-(trifluoromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.