
CAS 1263387-83-2
:4-(1-Piperazinylmethyl)pyridazine
Description:
4-(1-Piperazinylmethyl)pyridazine is a chemical compound characterized by its piperazine and pyridazine moieties, which contribute to its potential biological activity. The piperazine ring is a six-membered heterocyclic structure containing two nitrogen atoms, known for its role in various pharmacological applications, including as a scaffold in drug design. The pyridazine component, a five-membered ring with two adjacent nitrogen atoms, enhances the compound's reactivity and solubility properties. This compound may exhibit properties such as moderate to high polarity, which can influence its interaction with biological targets. Its structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The presence of both nitrogen-containing rings may also suggest potential for hydrogen bonding and interaction with biological macromolecules. Overall, 4-(1-Piperazinylmethyl)pyridazine is of interest in research contexts, particularly in the fields of pharmacology and organic synthesis, although specific biological activities and mechanisms would require further investigation.
Formula:C9H14N4
InChI:InChI=1S/C9H14N4/c1-2-11-12-7-9(1)8-13-5-3-10-4-6-13/h1-2,7,10H,3-6,8H2
InChI key:InChIKey=GZGZWKPLZGACGZ-UHFFFAOYSA-N
SMILES:C(C=1C=CN=NC1)N2CCNCC2
Synonyms:- 4-(1-Piperazinylmethyl)pyridazine
- Pyridazine, 4-(1-piperazinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.