CAS 126352-69-0

4,5,6,7-TETRAHYDROPYRAZOLO[1,5-A]PYRIMIDINE

Description:

4,5,6,7-Tetrahydropyrazolo[1,5-a]pyrimidine is a bicyclic organic compound characterized by its unique pyrazolo and pyrimidine ring structures. This compound features a saturated pyrazole ring fused to a pyrimidine, which contributes to its distinct chemical properties. It is typically a colorless to pale yellow solid, exhibiting moderate solubility in polar organic solvents. The presence of nitrogen atoms in its structure can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. This compound is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and anti-cancer properties. Its molecular structure allows for various functionalizations, which can enhance its pharmacological profile. Additionally, the compound's stability and reactivity can be influenced by substituents on the rings, making it a versatile scaffold for drug development. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, which can be exploited in material science and organic electronics.

Formula: C₆H₉N₃

InChI: InChI=1/C6H9N3/c1-3-7-6-2-4-8-9(6)5-1/h2,4,7H,1,3,5H2

SMILES: C1CNc2ccnn2C1

Synonyms:

• 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine(HCl salt)

Pyrazolo[1,5-a]pyrimidine, 4,5,6,7-tetrahydro-

CAS: 126352-69-0

Formula: C₆H₉N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 123.1558

Ref: IN-DA000SPC

4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidine

CAS: 126352-69-0

4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidine

Purity: 97%

Molecular weight: 123.16g/mol

Ref: 54-OR76170

4,5,6,7-Tetrahydropyrazolo[1,5-a]pyrimidine

CAS: 126352-69-0

Formula: C₆H₉N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 123.159

Ref: 10-F217484