
CAS 126357-22-0
:3-(2-Amino-4-thiazolyl)-6,8-dibromo-2H-1-benzopyran-2-one
Description:
3-(2-Amino-4-thiazolyl)-6,8-dibromo-2H-1-benzopyran-2-one is a chemical compound characterized by its complex structure, which includes a benzopyran core substituted with bromine and an amino-thiazole group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of bromine atoms often contributes to its reactivity and may influence its interaction with biological targets. The thiazole moiety can enhance the compound's pharmacological properties, potentially providing antimicrobial or anticancer activities. Additionally, the compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, due to the functional groups present. Its unique combination of elements and functional groups makes it a subject of interest for further studies in medicinal chemistry and drug development. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H6Br2N2O2S
InChI:InChI=1S/C12H6Br2N2O2S/c13-6-1-5-2-7(9-4-19-12(15)16-9)11(17)18-10(5)8(14)3-6/h1-4H,(H2,15,16)
InChI key:InChIKey=ZUMCLNMHFVMOBC-UHFFFAOYSA-N
SMILES:BrC1=C2C(C=C(C(=O)O2)C3=CSC(N)=N3)=CC(Br)=C1
Synonyms:- 3-(2-Amino-4-thiazolyl)-6,8-dibromo-2H-1-benzopyran-2-one
- 2H-1-Benzopyran-2-one, 3-(2-amino-4-thiazolyl)-6,8-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1-Benzopyran-2-one, 3-(2-amino-4-thiazolyl)-6,8-dibromo-
CAS:Formula:C12H6Br2N2O2SMolecular weight:402.0612
