CAS 126381-85-9
:(4-acetyl-3-benzoyloxy-5-methoxy-phenyl) benzoate
Description:
(4-acetyl-3-benzoyloxy-5-methoxy-phenyl) benzoate, with the CAS number 126381-85-9, is an organic compound characterized by its complex structure, which includes multiple functional groups. This substance features an acetyl group, a methoxy group, and a benzoyloxy moiety, contributing to its potential reactivity and solubility properties. The presence of aromatic rings suggests that it may exhibit significant stability and potential for π-π interactions, which can influence its physical properties such as melting point and solubility in organic solvents. Additionally, the compound may demonstrate biological activity due to its structural components, making it of interest in medicinal chemistry and material science. Its synthesis typically involves multi-step organic reactions, and it may be used in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.
Formula:C23H18O6
InChI:InChI=1/C23H18O6/c1-15(24)21-19(27-2)13-18(28-22(25)16-9-5-3-6-10-16)14-20(21)29-23(26)17-11-7-4-8-12-17/h3-14H,1-2H3
Synonyms:- Ethanone, 1-[2,4-bis(benzoyloxy)-6-methoxyphenyl]-
- 4-Acetyl-5-methoxy-1,3-phenylene dibenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.