CAS 126393-38-2

5-[4-(tert-butyl)phenyl]-2H-1,2,3,4-tetraazole

Description:

5-[4-(tert-butyl)phenyl]-2H-1,2,3,4-tetraazole, with the CAS number 126393-38-2, is an organic compound characterized by its tetraazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a tert-butyl group attached to a phenyl ring, contributing to its hydrophobic properties and influencing its solubility and reactivity. The presence of the tetraazole moiety imparts unique chemical properties, including potential applications in materials science and pharmaceuticals due to its ability to form coordination complexes and its stability under various conditions. The compound may exhibit interesting electronic properties due to the conjugation between the phenyl group and the tetraazole ring. Additionally, its structure suggests potential for biological activity, making it a candidate for further research in medicinal chemistry. Overall, the characteristics of this compound make it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₁₁H₁₄N₄

InChI: InChI=1/C11H14N4/c1-11(2,3)9-6-4-8(5-7-9)10-12-14-15-13-10/h4-7H,1-3H3,(H,12,13,14,15)

SMILES: CC(C)(C)c1ccc(cc1)c1n[nH]nn1

Synonyms:

• 5-(4-tert-butylphenyl)-2H-tetrazole

2H-Tetrazole, 5-[4-(1,1-dimethylethyl)phenyl]-

CAS: 126393-38-2

Formula: C₁₁H₁₄N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 202.2557

Ref: IN-DA000SQG

5-[4-(tert-Butyl)phenyl]-2H-1,2,3,4-tetraazole

CAS: 126393-38-2

5-[4-(tert-Butyl)phenyl]-2H-1,2,3,4-tetraazole

Purity: 95%

Ref: 54-OR29608

5-(4-tert-butylphenyl)-1H-1,2,3,4-tetrazole

CAS: 126393-38-2

Purity: 98%

Molecular weight: 202.2610016

Ref: 10-F752241

5-(4-(Tert-butyl)phenyl)-2H-tetrazole

CAS: 126393-38-2

5-(4-(Tert-butyl)phenyl)-2H-tetrazole

Purity: 95%

Molecular weight: 202.26g/mol

Ref: 54-OR79916