CAS 126395-32-2
:L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-β-hydroxy-3-methoxy-O-methyl-, threo-
Description:
L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-β-hydroxy-3-methoxy-O-methyl-, threo- is a derivative of the amino acid L-Tyrosine, which is crucial for the synthesis of neurotransmitters and hormones. This compound features a protective group, specifically a tert-butoxycarbonyl (Boc) group, which is commonly used in peptide synthesis to protect the amino group during chemical reactions. The presence of a methoxy group and a β-hydroxy group indicates that this compound may exhibit unique solubility and reactivity characteristics, potentially influencing its biological activity. The threo configuration suggests a specific stereochemistry that can affect the compound's interaction with biological targets. As a chemical entity, it may be utilized in research and pharmaceutical applications, particularly in the development of drugs that modulate neurotransmitter levels or in studies related to metabolic pathways involving tyrosine. Safety and handling precautions should be observed, as with any chemical substance, due to potential reactivity and biological effects.
Formula:C16H23NO7
InChI:InChI=1S/C16H23NO7/c1-16(2,3)24-15(21)17-12(14(19)20)13(18)9-6-7-10(22-4)11(8-9)23-5/h6-8,12-13,18H,1-5H3,(H,17,21)(H,19,20)/t12-,13+/m0/s1
InChI key:InChIKey=UGANDYWOMZTRQE-QWHCGFSZSA-N
SMILES:[C@@H]([C@H](NC(OC(C)(C)C)=O)C(O)=O)(O)C1=CC(OC)=C(OC)C=C1
Synonyms:- L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-β-hydroxy-3-methoxy-O-methyl-, threo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.