CymitQuimica logo

CAS 1263987-17-2

:

1-[(1,1-Dimethylethyl)dimethylsilyl]-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole

Description:
1-[(1,1-Dimethylethyl)dimethylsilyl]-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole is a complex organic compound characterized by its unique structural features, including an indole core, a silyl group, and a boron-containing moiety. The presence of the dimethylsilyl group enhances its stability and solubility in organic solvents, while the boron-containing dioxaborolane ring is often utilized in synthetic chemistry for its ability to participate in various reactions, such as cross-coupling. The compound's indole structure contributes to its potential biological activity, as indoles are known for their presence in many natural products and pharmaceuticals. Additionally, the bulky tert-butyl and tetramethyl groups provide steric hindrance, which can influence the reactivity and interaction of the molecule with other chemical species. Overall, this compound may serve as a valuable intermediate in organic synthesis and could have applications in medicinal chemistry, although specific biological activities would require further investigation.
Formula:C21H34BNO2Si
InChI:InChI=1S/C21H34BNO2Si/c1-15-11-12-18-16(13-15)17(14-23(18)26(9,10)19(2,3)4)22-24-20(5,6)21(7,8)25-22/h11-14H,1-10H3
InChI key:InChIKey=FQXNYVOXEXUDAN-UHFFFAOYSA-N
SMILES:[Si](C(C)(C)C)(C)(C)N1C=C(C=2C1=CC=C(C)C2)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 1H-Indole, 1-[(1,1-dimethylethyl)dimethylsilyl]-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 1-[(1,1-Dimethylethyl)dimethylsilyl]-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
  • 1-(tert-Butyldimethylsilyl)-5-methyl-1h-indol-3-ylboronic acid pinacol ester
  • 1-[tert-butyl(dimethyl)silyl]-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.