
CAS 1263987-41-2
:1H-Pyrazole-4-methanamine, N,α,3,5-tetramethyl-, ethanedioate (1:1)
Description:
1H-Pyrazole-4-methanamine, N,α,3,5-tetramethyl-, ethanedioate (1:1), with CAS number 1263987-41-2, is a chemical compound characterized by its pyrazole core structure, which is a five-membered ring containing two nitrogen atoms. The presence of the methanamine group indicates that it has an amine functional group, contributing to its potential reactivity and ability to form hydrogen bonds. The tetramethyl substitution suggests that the compound has four methyl groups attached to the nitrogen and carbon atoms, which can influence its steric and electronic properties, potentially enhancing its lipophilicity and solubility in organic solvents. The ethanedioate component indicates that the compound forms a salt with oxalic acid, which may affect its stability and solubility in various solvents. Overall, this compound may exhibit interesting biological or pharmacological activities due to its unique structural features, making it a subject of interest in medicinal chemistry and related fields.
Formula:C8H15N3·C2H2O4
InChI:InChI=1S/C8H15N3.C2H2O4/c1-5(9-4)8-6(2)10-11-7(8)3;3-1(4)2(5)6/h5,9H,1-4H3,(H,10,11);(H,3,4)(H,5,6)
InChI key:InChIKey=JFKYHRSIUAGINJ-UHFFFAOYSA-N
SMILES:C(NC)(C)C=1C(C)=NNC1C.C(C(O)=O)(O)=O
Synonyms:- 1H-Pyrazole-4-methanamine, N,α,3,5-tetramethyl-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.