CAS 1263988-40-4

1H-Pyrazole, 3-ethoxy-5-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazole, 3-ethoxy-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole core, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This specific derivative features an ethoxy group at the 3-position and a methyl group at the 5-position of the pyrazole ring, contributing to its unique chemical properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, making it useful in various applications, including pharmaceuticals and agrochemicals. The presence of the hydrochloride indicates that the compound can exist in a protonated form, which may influence its reactivity and interaction with biological systems. Its molecular structure suggests potential for diverse biological activity, although specific pharmacological properties would depend on further studies. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₆H₁₀N₂O·ClH

InChI: InChI=1S/C6H10N2O.ClH/c1-3-9-6-4-5(2)7-8-6;/h4H,3H2,1-2H3,(H,7,8);1H

InChI key: InChIKey=UUEKWBHKWFMZKK-UHFFFAOYSA-N

SMILES: O(CC)C=1C=C(C)NN1.Cl

Synonyms:

• 1H-Pyrazole, 3-ethoxy-5-methyl-, hydrochloride (1:1)

5-ethoxy-3-methyl-1H-pyrazole hydrochloride

CAS: 1263988-40-4

Formula: C₆H₁₁ClN₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 162.62

Ref: 10-F359934