CAS 1264-57-9: Decanoyl CoA
Description:Decanoyl CoA, also known as decanoyl coenzyme A, is a fatty acyl-CoA derivative characterized by its role in lipid metabolism. It is a thioester formed from decanoic acid and coenzyme A, featuring a long hydrophobic carbon chain, which contributes to its amphipathic nature. This compound plays a crucial role in the synthesis and degradation of fatty acids, serving as an important intermediate in various metabolic pathways, including β-oxidation and fatty acid elongation. Decanoyl CoA is involved in the regulation of energy metabolism and is essential for the biosynthesis of complex lipids. Its structure includes a decanoyl group linked to the coenzyme A moiety, which contains a nucleotide and a pantothenic acid derivative. The presence of the thiol group allows for the formation of thioester bonds, facilitating the transfer of acyl groups in metabolic reactions. Due to its involvement in metabolic processes, decanoyl CoA is significant in both cellular energy production and the synthesis of bioactive lipids.
Formula:C31H54N7O17P3S
InChI:InChI=1S/C31H54N7O17P3S/c1-4-5-6-7-8-9-10-11-22(40)59-15-14-33-21(39)12-13-34-29(43)26(42)31(2,3)17-52-58(49,50)55-57(47,48)51-16-20-25(54-56(44,45)46)24(41)30(53-20)38-19-37-23-27(32)35-18-36-28(23)38/h18-20,24-26,30,41-42H,4-17H2,1-3H3,(H,33,39)(H,34,43)(H,47,48)(H,49,50)(H2,32,35,36)(H2,44,45,46)/t20-,24-,25-,26+,30-/m1/s1
InChI key:InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-N
SMILES:O=C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(N2C=NC=3C(=NC=NC32)N)C(O)C1OP(=O)(O)O)CCCCCCCCC
- Synonyms:
- Capryl CoA
- Capryl coenzyme A
- Coenzyme A, S-decanoate
- Decanoyl CoA
- Decanoyl coenzyme A
- N-decanoylcoenzyme A
- S-{(9R)-1-[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)tetrahydrofuran-2-yl]-3,5,9-trihydroxy-8,8-dimethyl-3,5-dioxido-10,14-dioxo-2,4,6-trioxa-11,15-diaza-3lambda~5~,5lambda~5~-diphosphaheptadecan-17-yl} decanethioate (non-preferred name)
- S-{1-[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)tetrahydrofuran-2-yl]-3,5,9-trihydroxy-8,8-dimethyl-3,5-dioxido-10,14-dioxo-2,4,6-trioxa-11,15-diaza-3lambda~5~,5lambda~5~-diphosphaheptadecan-17-yl} decanethioate (non-preferred name)
- n-Decanoyl-CoA
