CymitQuimica logo

CAS 126400-75-7

:

4-nitro-2-aminobutyric acid

Description:
4-Nitro-2-aminobutyric acid is an organic compound characterized by the presence of both an amino group and a nitro group attached to a butyric acid backbone. This compound typically appears as a crystalline solid and is soluble in polar solvents due to its functional groups. The nitro group contributes to its potential reactivity, making it a candidate for various chemical transformations. The amino group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound may exhibit biological activity, which can be of interest in pharmaceutical research, particularly in the context of drug design or as a biochemical probe. Its molecular structure allows for potential applications in organic synthesis and materials science. Safety data should be consulted, as nitro compounds can sometimes be hazardous. Overall, 4-nitro-2-aminobutyric acid is a versatile compound with properties that make it relevant in both chemical and biological contexts.
Formula:C4H8N2O4
InChI:InChI=1/C4H8N2O4/c5-3(4(7)8)1-2-6(9)10/h3H,1-2,5H2,(H,7,8)/t3-/m0/s1
SMILES:C(CN(=O)=O)[C@@H](C(=O)O)N
Synonyms:
  • (2S)-2-amino-4-nitrobutanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.