CAS 1264036-70-5
:(3R)-1-(2-Pyrazinyl)-3-pyrrolidinol
Description:
(3R)-1-(2-Pyrazinyl)-3-pyrrolidinol is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a pyrazine moiety. The presence of the pyrazine ring contributes to its potential biological activity, as heterocyclic compounds often exhibit diverse pharmacological properties. The compound's stereochemistry, indicated by the (3R) designation, suggests that it has a specific three-dimensional arrangement that may influence its interactions with biological targets. This compound is likely to be soluble in polar solvents due to the presence of hydroxyl (-OH) groups, which can engage in hydrogen bonding. Its molecular structure may allow it to participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Additionally, the presence of nitrogen atoms in both the pyrazine and pyrrolidine rings may enhance its reactivity and ability to form complexes with metal ions or other ligands. Overall, (3R)-1-(2-Pyrazinyl)-3-pyrrolidinol represents a class of compounds that could be explored for therapeutic applications.
Formula:C8H11N3O
InChI:InChI=1S/C8H11N3O/c12-7-1-4-11(6-7)8-5-9-2-3-10-8/h2-3,5,7,12H,1,4,6H2/t7-/m1/s1
InChI key:InChIKey=ZUFKVTACICNZEH-SSDOTTSWSA-N
SMILES:O[C@H]1CN(CC1)C=2C=NC=CN2
Synonyms:- 3-Pyrrolidinol, 1-(2-pyrazinyl)-, (3R)-
- (3R)-1-(2-Pyrazinyl)-3-pyrrolidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.