CymitQuimica logo

CAS 126415-04-1

:

2-[2-[2-(2-Ethoxyethoxy)ethoxy]ethoxy]benzenamine

Description:
2-[2-[2-(2-Ethoxyethoxy)ethoxy]ethoxy]benzenamine, with the CAS number 126415-04-1, is an organic compound characterized by its complex ether and amine functional groups. This substance features a benzene ring substituted with a long-chain ethoxy group, which contributes to its solubility in organic solvents and potential hydrophilic properties. The presence of multiple ethoxy units indicates that it may exhibit surfactant-like behavior, making it useful in various applications, including as a dispersant or emulsifier. The amine group suggests potential reactivity, allowing for interactions with acids or electrophiles. Its molecular structure implies a relatively high molecular weight, which may influence its physical properties such as boiling point and melting point. Additionally, the compound's stability and reactivity can be affected by environmental factors, including pH and temperature. Overall, this compound's unique structure positions it as a candidate for research in fields such as materials science, pharmaceuticals, or chemical synthesis, where its ether and amine functionalities can be leveraged for specific applications.
Formula:C14H23NO4
InChI:InChI=1S/C14H23NO4/c1-2-16-7-8-17-9-10-18-11-12-19-14-6-4-3-5-13(14)15/h3-6H,2,7-12,15H2,1H3
InChI key:InChIKey=JMCDNYLYTBQFOF-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCC)C1=C(N)C=CC=C1
Synonyms:
  • 2-[2-[2-(2-Ethoxyethoxy)ethoxy]ethoxy]benzenamine
  • 2-(2-(2-(2-Ethoxyethoxy)ethoxy)ethoxy)aniline
  • Benzenamine, 2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.