CymitQuimica logo

CAS 1264193-14-7

:

6-Bromooxazolo[4,5-b]pyridine-2-carboxylic acid

Description:
6-Bromooxazolo[4,5-b]pyridine-2-carboxylic acid is a heterocyclic compound characterized by the presence of both bromine and carboxylic acid functional groups within its structure. This compound features a fused oxazole and pyridine ring system, which contributes to its unique chemical properties and potential biological activity. The bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its interactions in various chemical environments. The carboxylic acid group provides acidic characteristics, allowing for potential participation in acid-base reactions and hydrogen bonding. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural complexity and functional groups suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the presence of the bromine atom may facilitate further derivatization, expanding its utility in research and industrial applications. Overall, 6-Bromooxazolo[4,5-b]pyridine-2-carboxylic acid is a versatile compound with significant implications in various fields of chemistry.
Formula:C7H3BrN2O3
InChI:InChI=1S/C7H3BrN2O3/c8-3-1-4-5(9-2-3)10-6(13-4)7(11)12/h1-2H,(H,11,12)
InChI key:InChIKey=JGDWAIZAPIVVIR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NC=2C(O1)=CC(Br)=CN2
Synonyms:
  • Oxazolo[4,5-b]pyridine-2-carboxylic acid, 6-bromo-
  • 6-Bromooxazolo[4,5-b]pyridine-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.