CAS 1264193-15-8

Ethyl 6-bromooxazolo[4,5-b]pyridine-2-carboxylate

Description:

Ethyl 6-bromooxazolo[4,5-b]pyridine-2-carboxylate is a chemical compound characterized by its unique structural features, which include a bromine atom and an oxazole ring fused to a pyridine system. This compound belongs to a class of heterocyclic compounds, which are known for their diverse biological activities and potential applications in pharmaceuticals. The presence of the ethyl ester group contributes to its solubility and reactivity, making it a valuable intermediate in organic synthesis. The bromine substituent can serve as a site for further chemical modifications, enhancing its utility in medicinal chemistry. Additionally, the oxazole and pyridine moieties may impart specific electronic properties, influencing the compound's reactivity and interaction with biological targets. Overall, Ethyl 6-bromooxazolo[4,5-b]pyridine-2-carboxylate exemplifies the complexity and versatility of heterocyclic compounds in chemical research and development.

Formula: C₉H₇BrN₂O₃

InChI: InChI=1S/C9H7BrN2O3/c1-2-14-9(13)8-12-7-6(15-8)3-5(10)4-11-7/h3-4H,2H2,1H3

InChI key: InChIKey=DLKODISTHUKHJT-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1OC=2C(N1)=NC=C(Br)C2

Synonyms:

• 6-Bromooxazolo[4,5-b]pyridine-2-carboxylic acid ethyl ester
• Oxazolo[4,5-b]pyridine-2-carboxylic acid, 6-bromo-, ethyl ester
• Ethyl 6-bromooxazolo[4,5-b]pyridine-2-carboxylate

ethyl 6-bromo-[1,3]oxazolo[4,5-b]pyridine-2-carboxylate

CAS: 1264193-15-8

Formula: C₉H₇BrN₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 271.0675

Ref: IN-DA01JU6I