CAS 126432-17-5
:5-Oxo-6,8,11,14-eicosatetraenoic acid
Description:
5-Oxo-6,8,11,14-eicosatetraenoic acid, commonly referred to as 5-oxo-ETE, is a bioactive lipid molecule derived from arachidonic acid. It is characterized by a long carbon chain consisting of 20 carbon atoms and four double bonds, which classifies it as a polyunsaturated fatty acid. The presence of the oxo group at the fifth carbon position is significant, as it influences the molecule's reactivity and biological activity. This compound is known to play a role in various physiological processes, including inflammation and immune response modulation. It can act as a signaling molecule, interacting with specific receptors to elicit cellular responses. The compound's structure allows it to participate in the synthesis of other bioactive lipids, contributing to the complex network of lipid mediators in the body. Due to its involvement in inflammatory pathways, 5-oxo-ETE has garnered interest in research related to cardiovascular diseases and other inflammatory conditions. Its CAS number, 126432-17-5, is used for identification in chemical databases and regulatory contexts.
Formula:C20H30O3
InChI:InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h6-7,9-10,12-14,16H,2-5,8,11,15,17-18H2,1H3,(H,22,23)
InChI key:InChIKey=MEASLHGILYBXFO-UHFFFAOYSA-N
SMILES:C(C=CC=CCC=CCC=CCCCCC)(CCCC(O)=O)=O
Synonyms:- 5-Oxo-6,8,11,14-eicosatetraenoic acid
- 6,8,11,14-Eicosatetraenoic acid, 5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
