CAS 1264481-58-4

1H-Indazole, 3-chloro-4-methoxy-

Description:

1H-Indazole, 3-chloro-4-methoxy- is a heterocyclic organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a methoxy group (-OCH3) at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential reactivity due to the presence of the halogen and the methoxy group, which can participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, compounds of this type may possess biological activity, making them of interest in medicinal chemistry and drug development. The specific interactions and stability of 1H-Indazole, 3-chloro-4-methoxy- can be influenced by factors such as pH, temperature, and the presence of other chemical species. As with many indazole derivatives, it may also exhibit fluorescence or other photophysical properties, which can be useful in various applications.

Formula: C₈H₇ClN₂O

InChI: InChI=1S/C8H7ClN2O/c1-12-6-4-2-3-5-7(6)8(9)11-10-5/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=TZTQAVLIVAQNFP-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(NN=C2Cl)=CC=C1

Synonyms:

• 3-Chloro-4-methoxy-2H-indazole
• 3-Chloro-4-methoxy-1H-indazole
• 1H-Indazole, 3-chloro-4-methoxy-

3-Chloro-4-methoxy-1H-indazole

CAS: 1264481-58-4

Formula: C₈H₇ClN₂O

Molecular weight: 182.6070

Ref: IN-DA000ST1