CAS 1264511-10-5

B-(5-Fluoro-3-quinolinyl)boronic acid

Description:

B-(5-Fluoro-3-quinolinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a quinoline ring system. The compound features a fluorine atom at the 5-position of the quinoline, which can influence its electronic properties and reactivity. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. This specific compound may exhibit unique biological activities due to the quinoline moiety, which is often associated with pharmacological properties. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability. B-(5-Fluoro-3-quinolinyl)boronic acid may be utilized in the development of pharmaceuticals, particularly in the design of inhibitors for specific biological targets. Its reactivity and functionalization potential make it a useful intermediate in synthetic chemistry. As with many boronic acids, it is important to handle this compound with care, considering its potential reactivity and the need for appropriate storage conditions.

Formula: C₉H₇BFNO₂

InChI: InChI=1S/C9H7BFNO2/c11-8-2-1-3-9-7(8)4-6(5-12-9)10(13)14/h1-5,13-14H

InChI key: InChIKey=JMBPQVCINBCPSU-UHFFFAOYSA-N

SMILES: FC=1C2=C(N=CC(B(O)O)=C2)C=CC1

Synonyms:

• B-(5-Fluoro-3-quinolinyl)boronic acid
• Boronic acid, B-(5-fluoro-3-quinolinyl)-