
CAS 126456-06-2
:(2S,3S,4E,6E,8S,9S)-3-Amino-9-methoxy-2,6,8-trimethyl-10-phenyl-4,6-decadienoic acid
Description:
The chemical substance known as (2S,3S,4E,6E,8S,9S)-3-Amino-9-methoxy-2,6,8-trimethyl-10-phenyl-4,6-decadienoic acid, with the CAS number 126456-06-2, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features multiple chiral centers, which contribute to its unique three-dimensional structure and potential biological activity. The presence of an amino group indicates that it may exhibit properties typical of amino acids, such as participating in peptide formation or influencing metabolic pathways. The methoxy and phenyl groups suggest potential for aromatic interactions and solubility characteristics, which can affect its reactivity and interaction with biological systems. The conjugated diene system (4,6-decadienoic acid) implies that it may have interesting optical properties and could participate in various chemical reactions, including electrophilic additions or polymerization. Overall, this compound's structural complexity and functional groups make it a candidate for research in fields such as medicinal chemistry, biochemistry, and materials science.
Formula:C20H29NO3
InChI:InChI=1S/C20H29NO3/c1-14(10-11-18(21)16(3)20(22)23)12-15(2)19(24-4)13-17-8-6-5-7-9-17/h5-12,15-16,18-19H,13,21H2,1-4H3,(H,22,23)/b11-10+,14-12+/t15-,16-,18-,19-/m0/s1
InChI key:InChIKey=HJVCHYDYCYBBQX-HLTLHRPFSA-N
SMILES:[C@H](CC1=CC=CC=C1)([C@H](/C=C(/C=C/[C@@H]([C@@H](C(O)=O)C)N)\C)C)OC
Synonyms:- 4,6-Decadienoic acid, 3-amino-9-methoxy-2,6,8-trimethyl-10-phenyl-, (2S,3S,4E,6E,8S,9S)-
- 4,6-Decadienoic acid, 3-amino-9-methoxy-2,6,8-trimethyl-10-phenyl-, [2S-(2R*,3R*,4E,6E,8R*,9R*)]-
- (2S,3S,4E,6E,8S,9S)-3-Amino-9-methoxy-2,6,8-trimethyl-10-phenyl-4,6-decadienoic acid
- Adda
- GC 300
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4,6-Decadienoic acid, 3-amino-9-methoxy-2,6,8-trimethyl-10-phenyl-, (2S,3S,4E,6E,8S,9S)-
CAS:Formula:C20H29NO3Molecular weight:331.4492ADDA
CAS:ADDA is a non-proteinogenic amino acid existed in toxins produced by cyanobacteria.Formula:C20H29NO3Color and Shape:SolidMolecular weight:331.456

