CAS 126485-47-0
:11-O-syringylbergenin
Description:
11-O-syringylbergenin is a chemical compound that belongs to the class of phenolic glycosides. It is characterized by its unique structure, which includes a syringyl moiety and a bergenin backbone. This compound is known for its potential biological activities, including antioxidant and anti-inflammatory properties, which make it of interest in pharmacological research. The presence of the syringyl group contributes to its reactivity and interaction with various biological systems. Additionally, 11-O-syringylbergenin may exhibit effects on cellular signaling pathways, although specific mechanisms of action require further investigation. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in both research and potential therapeutic contexts. Overall, 11-O-syringylbergenin represents a fascinating area of study within natural products chemistry, with implications for health and disease management.
Formula:C23H24O13
InChI:InChI=1/C23H24O13/c1-31-11-4-8(5-12(32-2)15(11)25)22(29)34-7-13-16(26)18(28)21-20(35-13)14-9(23(30)36-21)6-10(24)19(33-3)17(14)27/h4-6,13,16,18,20-21,24-28H,7H2,1-3H3/t13-,16-,18+,20+,21-/m0/s1
Synonyms:- 11-O-Syringylbergenin
- [(2S,3R,4R,4aS,10bR)-3,4,8,10-tetrahydroxy-9-methoxy-6-oxo-2,3,4,4a,6,10b-hexahydropyrano[3,2-c]isochromen-2-yl]methyl 4-hydroxy-3,5-dimethoxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzoic acid, 4-hydroxy-3,5-dimethoxy-, [(2R,3S,4S,4aR,10bS)-2,3,4,4a,6,10b-hexahydro-3,4,8,10-tetrahydroxy-9-methoxy-6-oxopyrano[3,2-c][2]benzopyran-2-yl]methyl ester
CAS:Formula:C23H24O13Purity:98%Molecular weight:508.428911-o-Syringylbergenin
CAS:<p>11-o-Syringylbergenin is a natural phenolic glycoside, which is sourced primarily from various plant species known for their medicinal properties. This compound has garnered scientific interest due to its potential biological activities, which are attributed to its unique molecular structure involving a syringyl group attached to the bergenin backbone. The mode of action primarily involves antioxidant activity, which may contribute to its reported anti-inflammatory and hepatoprotective effects.</p>Formula:C23H24O13Purity:Min. 95%Molecular weight:508.4 g/mol


