CAS 12650-67-8

(2,3,4-trihydroxy-5-{[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl)methyl hexopyranoside

Description:

The chemical substance known as (2,3,4-trihydroxy-5-{[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl)methyl hexopyranoside, with the CAS number 12650-67-8, is a complex organic compound characterized by its multiple hydroxyl groups, which contribute to its hydrophilicity and potential reactivity. This compound features a hexopyranoside structure, indicating it is derived from a six-membered sugar ring, and contains cyclohexyl moieties that enhance its structural diversity. The presence of amino and hydroxymethyl groups suggests potential for hydrogen bonding and interactions with biological systems, making it of interest in biochemical applications. Its intricate structure may also imply specific stereochemical configurations that could influence its biological activity and solubility. Overall, this compound exemplifies the complexity often found in natural products and synthetic derivatives, highlighting its potential utility in pharmaceuticals or as a biochemical probe.

Formula: C₂₀H₃₅NO₁₃

InChI: InChI=1/C20H35NO13/c22-3-6-1-8(13(26)16(29)11(6)24)21-9-2-7(12(25)17(30)14(9)27)5-33-20-19(32)18(31)15(28)10(4-23)34-20/h1,7-32H,2-5H2

SMILES: C1=C(CO)C(C(C(C1NC1CC(COC2C(C(C(C(CO)O2)O)O)O)C(C(C1O)O)O)O)O)O

Validamycin D

CAS: 12650-67-8

Formula: C₂₀H₃₅NO₁₃

Molecular weight: 497.50

Ref: 4Z-V-046003

Validamycin D

Controlled Product

CAS: 12650-67-8

Formula: C₂₀H₃₅NO₁₃

Color and Shape: Neat

Molecular weight: 497.491

Ref: TR-V943443

Validamycin D

CAS: 12650-67-8

Validamycin D is an antifungal antibiotic produced by the fermentation of certain Streptomyces species. This compound acts by inhibiting the synthesis of trehalose, a crucial component in the cell structure and stress response of fungi. By disrupting trehalose production, Validamycin D effectively impairs the growth and viability of fungal cells, making it a potent agent in the management of fungal pathogens.

Formula: C₂₀H₃₅NO₁₃

Purity: Min. 95%

Molecular weight: 497.5 g/mol

Ref: 3D-MAA65067

Validamycin D

CAS: 12650-67-8

Formula: C₂₀H₃₅NO₁₃

Molecular weight: 497.5

Ref: ST-EA-CP-V77003