CAS 12650-70-3

(3-{[4-(hexopyranosyloxy)-2,3-dihydroxy-5-(hydroxymethyl)cyclohexyl]amino}-4,5,6-trihydroxycyclohex-1-en-1-yl)methyl hexopyranoside

Description:

The chemical substance with the name "(3-{[4-(hexopyranosyloxy)-2,3-dihydroxy-5-(hydroxymethyl)cyclohexyl]amino}-4,5,6-trihydroxycyclohex-1-en-1-yl)methyl hexopyranoside" and CAS number "12650-70-3" is a complex glycosylated compound characterized by multiple hydroxyl groups and a hexopyranoside moiety. This structure suggests it may exhibit significant hydrophilicity due to the presence of multiple hydroxyl (-OH) groups, which can enhance solubility in polar solvents, particularly water. The presence of amino and cyclohexene functionalities indicates potential biological activity, possibly as a natural product or a derivative with pharmacological relevance. The hexopyranoside units imply that it may interact with biological systems, potentially serving as a substrate or inhibitor in enzymatic reactions. Additionally, the stereochemistry and specific arrangement of functional groups could influence its reactivity and interactions with other molecules, making it of interest in medicinal chemistry and biochemistry. Overall, this compound's structural complexity suggests it may have unique properties and applications in various fields, including pharmaceuticals and biochemistry.

Formula: C₂₆H₄₅NO₁₈

InChI: InChI=1/C26H45NO18/c28-3-7-1-9(15(33)21(39)24(7)45-26-23(41)20(38)17(35)12(5-30)44-26)27-10-2-8(13(31)18(36)14(10)32)6-42-25-22(40)19(37)16(34)11(4-29)43-25/h2,7,9-41H,1,3-6H2

SMILES: C1C(CO)C(C(C(C1NC1C=C(COC2C(C(C(C(CO)O2)O)O)O)C(C(C1O)O)O)O)O)OC1C(C(C(C(CO)O1)O)O)O

Validamycin C

CAS: 12650-70-3

Formula: C₂₆H₄₅NO₁₈

Molecular weight: 659.64

Ref: 4Z-V-046002

Validamycin C

Controlled Product

CAS: 12650-70-3

Formula: C₂₆H₄₅NO₁₈

Color and Shape: Neat

Molecular weight: 659.631

Ref: TR-V943438

Validamycin C

CAS: 12650-70-3

Validamycin C is an aminoglycoside antifungal antibiotic, which is derived from the soil bacterium Streptomyces hygroscopicus. It functions primarily by inhibiting the synthesis of trehalase, an enzyme crucial for the breakdown of trehalose into glucose monomers. This inhibition disrupts the cellular function of fungi, particularly affecting their osmotic balance and cellular integrity, ultimately leading to the control of fungal growth.

Formula: C₂₆H₄₅NO₁₈

Purity: Min. 95%

Molecular weight: 659.6 g/mol

Ref: 3D-MAA65070

Validamycin C

CAS: 12650-70-3

Formula: C₂₆H₄₅NO₁₈

Molecular weight: 659.64

Ref: ST-EA-CP-V77002