CAS 12650-70-3
:(3-{[4-(hexopyranosyloxy)-2,3-dihydroxy-5-(hydroxymethyl)cyclohexyl]amino}-4,5,6-trihydroxycyclohex-1-en-1-yl)methyl hexopyranoside
Description:
The chemical substance with the name "(3-{[4-(hexopyranosyloxy)-2,3-dihydroxy-5-(hydroxymethyl)cyclohexyl]amino}-4,5,6-trihydroxycyclohex-1-en-1-yl)methyl hexopyranoside" and CAS number "12650-70-3" is a complex glycosylated compound characterized by multiple hydroxyl groups and a hexopyranoside moiety. This structure suggests it may exhibit significant hydrophilicity due to the presence of multiple hydroxyl (-OH) groups, which can enhance solubility in polar solvents, particularly water. The presence of amino and cyclohexene functionalities indicates potential biological activity, possibly as a natural product or a derivative with pharmacological relevance. The hexopyranoside units imply that it may interact with biological systems, potentially serving as a substrate or inhibitor in enzymatic reactions. Additionally, the stereochemistry and specific arrangement of functional groups could influence its reactivity and interactions with other molecules, making it of interest in medicinal chemistry and biochemistry. Overall, this compound's structural complexity suggests it may have unique properties and applications in various fields, including pharmaceuticals and biochemistry.
Formula:C26H45NO18
InChI:InChI=1/C26H45NO18/c28-3-7-1-9(15(33)21(39)24(7)45-26-23(41)20(38)17(35)12(5-30)44-26)27-10-2-8(13(31)18(36)14(10)32)6-42-25-22(40)19(37)16(34)11(4-29)43-25/h2,7,9-41H,1,3-6H2
SMILES:C1C(CO)C(C(C(C1NC1C=C(COC2C(C(C(C(CO)O2)O)O)O)C(C(C1O)O)O)O)O)OC1C(C(C(C(CO)O1)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Validamycin C
CAS:Validamycin C is an aminoglycoside antifungal antibiotic, which is derived from the soil bacterium Streptomyces hygroscopicus. It functions primarily by inhibiting the synthesis of trehalase, an enzyme crucial for the breakdown of trehalose into glucose monomers. This inhibition disrupts the cellular function of fungi, particularly affecting their osmotic balance and cellular integrity, ultimately leading to the control of fungal growth.Formula:C26H45NO18Purity:Min. 95%Molecular weight:659.6 g/mol



