CAS 12650-71-4

2,3-dihydroxy-6-(hydroxymethyl)-4-{[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl 4-O-hexopyranosylhexopyranoside

Description:

2,3-Dihydroxy-6-(hydroxymethyl)-4-{[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}cyclohexyl 4-O-hexopyranosylhexopyranoside, with CAS number 12650-71-4, is a complex glycosylated compound characterized by multiple hydroxyl groups and a cyclohexene structure. This substance features a cyclohexyl backbone that is substituted with various hydroxymethyl and hydroxy groups, contributing to its hydrophilicity and potential biological activity. The presence of glycosyl moieties suggests that it may play a role in biological processes, possibly as a glycoside, which can influence solubility and reactivity. Its intricate structure indicates potential applications in pharmaceuticals or biochemistry, particularly in areas related to carbohydrate chemistry or medicinal chemistry. The compound's stability, solubility, and reactivity would be influenced by its functional groups, making it a candidate for further study in drug development or as a biochemical probe. However, specific properties such as melting point, solubility, and biological activity would require empirical investigation for comprehensive understanding.

Formula: C₂₆H₄₅NO₁₈

InChI: InChI=1/C26H45NO18/c28-3-7-1-9(14(33)17(36)13(7)32)27-10-2-8(4-29)23(19(38)15(10)34)44-26-22(41)20(39)24(12(6-31)43-26)45-25-21(40)18(37)16(35)11(5-30)42-25/h1,8-41H,2-6H2

SMILES: C1=C(CO)C(C(C(C1NC1CC(CO)C(C(C1O)O)OC1C(C(C(C(CO)O1)OC1C(C(C(C(CO)O1)O)O)O)O)O)O)O)O

Validamycin E

CAS: 12650-71-4

Formula: C₂₆H₄₅NO₁₈

Molecular weight: 659.64

Ref: 4Z-V-046004

Validamycin E

Controlled Product

CAS: 12650-71-4

Formula: C₂₆H₄₅NO₁₈

Color and Shape: Neat

Molecular weight: 659.631

Ref: TR-V943445

Validamycin E

CAS: 12650-71-4

Validamycin E is an antifungal antibiotic, which is a secondary metabolite derived from the actinobacterium Streptomyces hygroscopicus. Its mode of action involves the inhibition of trehalase, an enzyme crucial for the hydrolysis of trehalose into glucose, disrupting essential energy pathways in fungi. By inhibiting trehalase, Validamycin E effectively interferes with the growth and development of fungal pathogens.

Formula: C₂₆H₄₅NO₁₈

Purity: Min. 95%

Molecular weight: 659.6 g/mol

Ref: 3D-MAA65071

Validamycin E

CAS: 12650-71-4

Formula: C₂₆H₄₅NO₁₈

Molecular weight: 659.64

Ref: ST-EA-CP-V77004