CAS 126502-10-1
:9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3,9-dihydro-6H-purine-6-thione
Description:
The chemical substance known as 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3,9-dihydro-6H-purine-6-thione, with the CAS number 126502-10-1, is a purine derivative characterized by the presence of a tetrahydrofuran moiety and a thione functional group. This compound features a bicyclic purine structure, which is essential in various biological processes, particularly in nucleic acid metabolism. The hydroxymethyl group on the tetrahydrofuran ring contributes to its solubility and potential interactions with biological targets. The thione group indicates the presence of sulfur, which can influence the compound's reactivity and biological activity. This substance may exhibit properties such as antiviral or anticancer activity, making it of interest in medicinal chemistry. Its stereochemistry, particularly the (2R,5S) configuration, plays a crucial role in its biological interactions and pharmacological profile. Overall, this compound represents a unique combination of structural features that may contribute to its potential therapeutic applications.
Formula:C10H12N4O2S
InChI:InChI=1/C10H12N4O2S/c15-3-6-1-2-7(16-6)14-5-13-8-9(14)11-4-12-10(8)17/h4-7,15H,1-3H2,(H,11,12,17)/t6-,7+/m0/s1
Synonyms:- [(2S,5R)-5-(6-sulfanyl-9H-purin-9-yl)tetrahydrofuran-2-yl]methanol
- 2-furanmethanol, tetrahydro-5-(6-mercapto-9H-purin-9-yl)-, (2S,5R)-
- 9-(2,3-dideoxy-β-D-ribofuranosyl)-6-mercaptopurine
- 2',3'-Dideoxy-6-thioinosine
- 6-Thiolpurine-2',3'-dideoxyriboside
- Inosine, 2',3'-dideoxy-6-thio- (9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2',3'-Dideoxy-6-thio-inosine
CAS:2',3'-Dideoxy-6-thio-inosine is a nucleoside analog that is used in vitro for the investigation of viral replication. 2',3'-Dideoxy-6-thio-inosine is a potent inhibitor of human immunodeficiency virus type 1 (HIV-1) infection, and has been shown to inhibit the synthesis of viral dna. The in vitro activity of this drug against HIV has been shown to be greater than 200 times more potent than zidovudine or didanosine. 2',3'-Dideoxy-6-thio-inosine also inhibits the growth of some cell lines, including those derived from infected T cells, indicating that it may have cytocidal effects.
Formula:C10H12N4O2SPurity:Min. 95%Molecular weight:252.29 g/mol
