CAS 126502-17-8

N(6)-methyl-2',3'-dideoxy-2'-fluoro-beta-arabinofuranosyladenine

Description:

N(6)-methyl-2',3'-dideoxy-2'-fluoro-beta-arabinofuranosyladenine, commonly referred to as a nucleoside analog, is characterized by its structural modifications that enhance its antiviral properties. This compound features a modified ribose sugar, specifically a 2'-fluoro substitution and the absence of the 2' and 3' hydroxyl groups, which contribute to its stability and resistance to nucleases. The N(6)-methyl group on the adenine base enhances its binding affinity to viral enzymes, making it a potential candidate for antiviral therapies. Its unique structure allows it to mimic natural nucleosides, thereby interfering with viral replication processes. The compound is typically evaluated for its efficacy against various viral infections, particularly those caused by retroviruses. Additionally, its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are crucial for determining its therapeutic potential. Overall, N(6)-methyl-2',3'-dideoxy-2'-fluoro-beta-arabinofuranosyladenine represents a significant advancement in the development of antiviral agents.

Formula: C₁₁H₁₄FN₅O₂

InChI: InChI=1/C11H14FN5O2/c1-13-9-8-10(15-4-14-9)17(5-16-8)11-7(12)2-6(3-18)19-11/h4-7,11,18H,2-3H2,1H3,(H,13,14,15)/t6-,7-,11+/m0/s1

Synonyms:

• 9-(2,3-Dideoxy-2-fluoro-beta-D-threo-pentofuranosyl)-N-methyl-9H-purin-6-amine
• Fmadda
• Nsc 625374
• 9H-Purin-6-amine, 9-(2,3-dideoxy-2-fluoro-beta-D-threo-pentofuranosyl)-N-methyl-
• 9-[(4xi)-2,3-dideoxy-2-fluoro-alpha-L-glycero-pentofuranosyl]-N-methyl-9H-purin-6-amine