CAS 126508-26-7

chloro-[(4-ethoxyphenyl)methyl]magnesium

Description:

Chloro-[(4-ethoxyphenyl)methyl]magnesium, with the CAS number 126508-26-7, is an organomagnesium compound that belongs to the class of Grignard reagents. This compound features a magnesium atom bonded to a chloro group and a 4-ethoxyphenylmethyl group, which contributes to its reactivity and utility in organic synthesis. Grignard reagents are known for their ability to act as nucleophiles, allowing them to react with a variety of electrophiles, including carbonyl compounds, to form alcohols. The presence of the ethoxy group enhances the solubility of the compound in organic solvents, making it easier to handle in laboratory settings. Additionally, the aromatic ring provides stability and can influence the reactivity of the magnesium center. As with many organometallic compounds, chloro-[(4-ethoxyphenyl)methyl]magnesium must be handled under an inert atmosphere to prevent reaction with moisture or air, which can lead to decomposition or unwanted side reactions. Proper safety precautions are essential due to its reactivity and potential hazards.

Formula: C₉H₁₁ClMgO

InChI: InChI=1/C9H11O.ClH.Mg/c1-3-10-9-6-4-8(2)5-7-9;;/h4-7H,2-3H2,1H3;1H;/q;;+1/p-1/rC9H11ClMgO/c1-2-12-9-5-3-8(4-6-9)7-11-10/h3-6H,2,7H2,1H3

SMILES: CCOC1C=CC(=C)C=C1.Cl.[Mg]