CAS 126509-46-4
:eponemycin
Description:
Eponemycin is a natural product with notable biological activity, primarily recognized for its role as an antibiotic and potential anticancer agent. It is classified as a member of the class of compounds known as polyketides, which are characterized by their complex structures derived from the polymerization of acetyl and other acyl units. Eponemycin exhibits a unique mechanism of action, often targeting specific cellular processes, which contributes to its effectiveness against various pathogens and cancer cells. The compound has been studied for its ability to inhibit protein synthesis, making it a subject of interest in medicinal chemistry and drug development. Its structure includes multiple functional groups that contribute to its solubility and reactivity, influencing its pharmacokinetic properties. Research into eponemycin continues to explore its potential therapeutic applications, as well as its biosynthetic pathways and the possibility of synthetic analogs that could enhance its efficacy or reduce toxicity. Overall, eponemycin represents a significant area of study within the field of natural product chemistry and pharmacology.
Formula:C20H34N2O6
InChI:InChI=1/C20H34N2O6/c1-13(2)7-5-6-8-17(25)21-16(10-23)19(27)22-15(9-14(3)4)18(26)20(11-24)12-28-20/h13,15-16,23-24H,3,5-12H2,1-2,4H3,(H,21,25)(H,22,27)/t15-,16?,20+/m0/s1
Synonyms:- Heptanamide, N-[(1S)-1-(hydroxymethyl)-2-[[(1S)-1-[[(2R)-2-(hydroxymethyl)-2-oxiranyl]carbonyl]-3-methyl-3-buten-1-yl]amino]-2-oxoethyl]-6-methyl-
- eponemycin
- 1,2-Epoxy-2-hydroxymethyl-4-(N-isooctanoylserylamino)-6-methylhept-6-ene-3-one
- N-[3-hydroxy-1-({(2S)-1-[(2R)-2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopent-4-en-2-yl}amino)-1-oxopropan-2-yl]-6-methylheptanamide
- Heptanamide, N-(1-(hydroxymethyl)-2-((1-((2-(hydroxymethyl)oxiranyl)carbonyl)-3-methyl-3-butenyl)amino)-2-oxoethyl)-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Eponemycin
CAS:Eponemycin is an antibiotic with antitumor properties. It exhibits cytotoxicity against cancer cell lines B16-F10, L1210, P388, and HCT-116, with IC50 values of 0.0017, 0.01, 0.031, and 0.0097 µg/mL, respectively. In B16-F10 and mitomycin C, Eponemycin inhibits DNA synthesis, with IC50 values of 0.1 µg/mL and 0.41 µg/mL, respectively.Formula:C20H34N2O6Color and Shape:SolidMolecular weight:398.494
