CAS 126521-84-4

α-2-Benzothiazolyl-α-methyl-2-benzothiazolemethanol

Description:

α-2-Benzothiazolyl-α-methyl-2-benzothiazolemethanol, identified by its CAS number 126521-84-4, is a chemical compound that belongs to the class of benzothiazole derivatives. This substance typically exhibits characteristics such as a complex molecular structure, which includes multiple aromatic rings and a hydroxymethyl group. The presence of the benzothiazole moiety often imparts notable biological activity, making such compounds of interest in medicinal chemistry and materials science. Physically, it may be a solid at room temperature, with potential solubility in organic solvents, depending on its specific functional groups. The compound may also display interesting photophysical properties, which can be leveraged in various applications, including fluorescence and sensing technologies. Additionally, its chemical stability and reactivity can be influenced by the substituents on the benzothiazole rings, which can affect its interactions in biological systems or with other chemical entities. Overall, this compound represents a fascinating area of study within the realm of organic chemistry and its applications.

Formula: C₁₆H₁₂N₂OS₂

InChI: InChI=1S/C16H12N2OS2/c1-16(19,14-17-10-6-2-4-8-12(10)20-14)15-18-11-7-3-5-9-13(11)21-15/h2-9,19H,1H3

InChI key: InChIKey=SIBUPRJXUCVTOR-UHFFFAOYSA-N

SMILES: C(C)(O)(C1=NC=2C(S1)=CC=CC2)C3=NC=4C(S3)=CC=CC4

Synonyms:

• 1,1-Bis(benzo[d]thiazol-2-yl)ethanol
• 2-Benzothiazolemethanol, α-2-benzothiazolyl-α-methyl-
• α-2-Benzothiazolyl-α-methyl-2-benzothiazolemethanol
• 1,1-Bis(1,3-benzothiazol-2-yl)ethanol