CAS 126522-74-5
:1-(MESITYLSULFONYL)PYRROLIDINE-2-CARBOXYLIC ACID
Description:
1-(Mesitylsulfonyl)pyrrolidine-2-carboxylic acid, identified by its CAS number 126522-74-5, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a mesitylsulfonyl group contributes to its unique properties, enhancing its reactivity and solubility in various organic solvents. This compound features a carboxylic acid functional group, which imparts acidic characteristics and allows for potential interactions in biochemical systems. Typically, compounds of this nature are utilized in organic synthesis and may serve as intermediates in the production of pharmaceuticals or agrochemicals. The sulfonyl group can also influence the compound's polarity and stability, making it a valuable building block in medicinal chemistry. Additionally, the stereochemistry of the pyrrolidine ring can affect the biological activity of the compound, making it an interesting subject for further research in drug development and design. Overall, 1-(mesitylsulfonyl)pyrrolidine-2-carboxylic acid exemplifies the complexity and utility of heterocyclic compounds in chemical applications.
Formula:C14H18NO4S
InChI:InChI=1/C14H19NO4S/c1-9-7-10(2)13(11(3)8-9)20(18,19)15-6-4-5-12(15)14(16)17/h7-8,12H,4-6H2,1-3H3,(H,16,17)/p-1/t12-/m1/s1
SMILES:Cc1cc(C)c(c(C)c1)S(=O)(=O)N1CCC[C@@H]1C(=O)[O-]
Synonyms:- 1-(Mesitylsulfonyl)proline
- Proline, 1-[(2,4,6-Trimethylphenyl)Sulfonyl]-
- 1-[(2,4,6-Trimethylphenyl)Sulfonyl]Proline
- (2S)-1-[(2,4,6-trimethylphenyl)sulfonyl]pyrrolidine-2-carboxylate
- (2R)-1-[(2,4,6-trimethylphenyl)sulfonyl]pyrrolidine-2-carboxylate
- 1-(mesitylsulfonyl)pyrrolidine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
