CymitQuimica logo

CAS 126533-79-7

:

Ethyl 2-(4-methoxy-phenylamino)-4-thiazolecarboxylate

Description:
Ethyl 2-(4-methoxy-phenylamino)-4-thiazolecarboxylate, identified by its CAS number 126533-79-7, is a chemical compound characterized by its thiazole and ethyl ester functional groups. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its potential biological activity. The presence of the 4-methoxy-phenylamino group indicates that it has an aromatic system, which can enhance its stability and reactivity. Ethyl esters are typically known for their pleasant odors and are often used in organic synthesis and as intermediates in the production of pharmaceuticals. The compound may exhibit various properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity with nucleophiles due to the presence of the carboxylate group. Its specific applications and biological activities would depend on further studies, but compounds of this nature are often explored for their potential in medicinal chemistry and drug development.
Formula:C13H14N2O3S
InChI:InChI=1/C13H14N2O3S/c1-3-18-12(16)11-8-19-13(15-11)14-9-4-6-10(17-2)7-5-9/h4-8H,3H2,1-2H3,(H,14,15)
InChI key:IPUZBCRNFHBQLY-UHFFFAOYSA-N
SMILES:CCOC(=O)c1csc(Nc2ccc(cc2)OC)n1
Synonyms:
  • 126533-79-7
  • Ethyl 2-[(4-methoxyphenyl)amino]-1,3-thiazole-4-carboxylate
  • Ethyl 2-(4-methoxy-phenylamino)-4-thiazolecarboxylate
Found 2 products.