CAS 126533-96-8

(2-Morpholino-1,3-thiazol-4-yl)methanol

Description:

(2-Morpholino-1,3-thiazol-4-yl)methanol is a chemical compound characterized by its unique structural features, which include a morpholine ring and a thiazole moiety. The presence of the morpholine group contributes to its potential solubility in polar solvents, while the thiazole ring may impart biological activity, making it of interest in pharmaceutical research. This compound typically exhibits properties such as moderate to high polarity due to the hydroxymethyl group, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The compound may also display specific reactivity patterns typical of thiazoles and alcohols, which could be exploited in synthetic pathways. Additionally, safety and handling considerations should be taken into account, as with any chemical substance, particularly regarding its stability and potential toxicity. Overall, (2-Morpholino-1,3-thiazol-4-yl)methanol represents a versatile scaffold for further chemical exploration and development.

Formula: C₈H₁₂N₂O₂S

InChI: InChI=1/C8H12N2O2S/c11-5-7-6-13-8(9-7)10-1-3-12-4-2-10/h6,11H,1-5H2

SMILES: C1COCCN1c1nc(CO)cs1

Synonyms:

• 4-(Hydroxymethyl)-2-morpholin-4-yl-1,3-thiazole
• (2-Morpholin-4-yl-1,3-thiazol-4-yl)methanol

[2-(morpholin-4-yl)-1,3-thiazol-4-yl]methanol

CAS: 126533-96-8

Formula: C₈H₁₂N₂O₂S

Molecular weight: 200.2581

Ref: IN-DA000SVZ

4-(Hydroxymethyl)-2-(morpholin-4-yl)-1,3-thiazole

CAS: 126533-96-8

4-(Hydroxymethyl)-2-(morpholin-4-yl)-1,3-thiazole

Purity: ≥95%

Ref: 54-OR12363