CymitQuimica logo

CAS 126535-89-5

:

METHYL 2-[TERT-BUTOXYCARBONYLIMINO]-3,3,3-TRIFLUOROPROPIONATE

Description:
Methyl 2-[tert-butoxycarbonylimino]-3,3,3-trifluoropropionate, with the CAS number 126535-89-5, is a chemical compound characterized by its unique functional groups and fluorinated structure. It features a trifluoropropionate moiety, which imparts significant electronegativity and influences its reactivity and solubility. The presence of the tert-butoxycarbonyl (Boc) group provides stability and protection to the amine functionality, making it useful in synthetic organic chemistry, particularly in peptide synthesis and other applications where selective protection is required. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, where fluorinated compounds often exhibit enhanced biological activity. Additionally, the compound's properties, such as boiling point, melting point, and solubility, can vary based on environmental conditions and the presence of other solvents or reagents. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H12F3NO4
InChI:InChI=1/C9H12F3NO4/c1-8(2,3)17-7(15)13-5(6(14)16-4)9(10,11)12/h1-4H3/b13-5-
SMILES:CC(C)(C)OC(=O)/N=C(/C(=O)OC)\C(F)(F)F
Synonyms:
  • Methyl 2-[tert-Butoxycarbonylimino]-3,3,3-
  • methyl (2Z)-2-tert-butoxycarbonylimino-3,3,3-trifluoro-propanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.