
CAS 126538-82-7
:5-Iodo-6-(trifluoromethyl)-4(3H)-pyrimidinone
Description:
5-Iodo-6-(trifluoromethyl)-4(3H)-pyrimidinone is a heterocyclic organic compound characterized by its pyrimidinone structure, which features a pyrimidine ring with a carbonyl group and various substituents. The presence of an iodine atom at the 5-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carbonyl group. Its trifluoromethyl group enhances lipophilicity, making it potentially useful in medicinal chemistry and agrochemical applications. The compound may also display interesting biological activities, which can be attributed to the unique electronic and steric effects of the halogen and trifluoromethyl substituents. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 5-Iodo-6-(trifluoromethyl)-4(3H)-pyrimidinone is a valuable compound in the field of synthetic organic chemistry.
Formula:C5H2F3IN2O
InChI:InChI=1S/C5H2F3IN2O/c6-5(7,8)3-2(9)4(12)11-1-10-3/h1H,(H,10,11,12)
InChI key:InChIKey=CUCFZLFJNGYXRT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(I)C(=O)N=CN1
Synonyms:- 5-Iodo-6-(trifluoromethyl)-4(3H)-pyrimidinone
- 4(1H)-Pyrimidinone, 5-iodo-6-(trifluoromethyl)-
- 4(3H)-Pyrimidinone, 5-iodo-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.