CAS 12655-04-8

Antimonate(2-), bis[μ-[[(2R,3R)-2,3-di(hydroxy-κO)butanedioato(4-)-κO1,κO4]]di-, barium (1:1)

Description:

Antimonate(2-), bis[μ-[[(2R,3R)-2,3-di(hydroxy-κO)butanedioato(4-)-κO1,κO4]]di-, barium (1:1) is a complex chemical compound characterized by its coordination with barium ions and antimonate anions. The structure features a barium ion coordinated to two bidentate ligands derived from a dihydroxybutanedioic acid derivative, which contributes to its chelating properties. The presence of hydroxyl groups enhances solubility and reactivity, while the antimonate ion provides a unique oxidation state of antimony, typically exhibiting properties associated with metalloids. This compound may exhibit interesting thermal and electrochemical properties, making it relevant in various applications, including materials science and catalysis. Its stability and reactivity can be influenced by pH and the presence of other ions in solution. As with many metal-organic complexes, the specific interactions and bonding geometries play a crucial role in determining its overall behavior in chemical reactions and potential applications in fields such as environmental chemistry and biochemistry.

Formula: C₈H₄O₁₂Sb₂·Ba

InChI: InChI=1S/2C4H4O6.Ba.2Sb/c2*5-1(3(7)8)2(6)4(9)10;;;/h2*1-2H,(H,7,8)(H,9,10);;;/q2*-2;+2;2*+3/p-4

InChI key: InChIKey=CAYWJHDPQVVUFD-UHFFFAOYSA-J

SMILES: O=C1[O-][Sb+3]23[O-]C(C(=O)[O-]2)C4[O-][Sb+3]5([O-]C(C1[O-]3)C(=O)[O-]5)[O-]C4=O.[Ba+2]

Synonyms:

• Butanedioic acid, 2,3-dihydroxy- [R-(R*,R*)]-, antimony complex
• Antimonate(2-), bis[μ-[[(2R,3R)-2,3-di(hydroxy-κO)butanedioato(4-)-κO1,κO4]]di-, barium (1:1)
• Antimonate(2-), bis[μ-[2,3-dihydroxybutanedioato(4-)-O1,O2:O3,O4]]di-, barium (1:1), stereoisomer
• Antimonate(1-), oxo(tartrato)-, barium
• Barium antimonyl tartrate

Antimonate(2-), bis[μ-[[(2R,3R)-2,3-di(hydroxy-κO)butanedioato(4-)-κO1,κO4]]di-, barium (1:1)

CAS: 12655-04-8

Formula: C₈H₄BaO₁₂Sb₂

Molecular weight: 672.9572

Ref: IN-DA000SXR