CAS 126550-86-5: ALPHA-D-GAL-[1->4]-BETA-D-GAL-[1->4]-BETA-D-GLC-1->O-SPHINGOSINE
Description:Alpha-D-Gal-[1->4]-Beta-D-Gal-[1->4]-Beta-D-Glc-1->O-Sphingosine, with the CAS number 126550-86-5, is a complex glycosphingolipid. This compound features a sphingosine backbone, which is a long-chain amino alcohol, and is characterized by the presence of sugar moieties, specifically galactose and glucose, linked through glycosidic bonds. The structure indicates that it has multiple sugar units, which contribute to its hydrophilic properties, while the sphingosine portion provides hydrophobic characteristics. This amphiphilic nature allows it to play significant roles in cellular membranes and signaling pathways. Glycosphingolipids like this compound are often involved in cell recognition, signaling, and interactions with other biomolecules. They are also important in the context of various biological processes, including immune response and neuronal function. The specific arrangement of the sugar units and the sphingosine backbone can influence the biological activity and function of this glycosphingolipid in different physiological contexts.
Formula:C36H67NO17
InChI:InChI=1/C36H67NO17/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-21(41)20(37)19-49-34-30(47)27(44)32(23(17-39)51-34)54-36-31(48)28(45)33(24(18-40)52-36)53-35-29(46)26(43)25(42)22(16-38)50-35/h14-15,20-36,38-48H,2-13,16-19,37H2,1H3/b15-14+/t20-,21+,22+,23+,24+,25-,26-,27+,28+,29+,30+,31+,32+,33-,34+,35+,36-/m0/s1
- Synonyms:
- Globotriaosylsphingosine
- Α-D-Gal-(1→4)-Β-D-Gal-(1→4)-Β-D-Glc-1→O-Sphingosine
- Globotriaosyl Lysosphingolipid
- Globotriaosylsphingosine from porcine blood
- (2S,3R,4E)-2-amino-3-hydroxyoctadec-4-en-1-yl alpha-D-galactopyranosyl-(1->4)-beta-D-galactopyranosyl-(1->4)-beta-D-glucopyranoside