
CAS 126565-88-6
:2-(3-Buten-1-yl)-3,5,5-trimethyl-2-cyclohexen-1-one
Description:
2-(3-Buten-1-yl)-3,5,5-trimethyl-2-cyclohexen-1-one, with the CAS number 126565-88-6, is an organic compound characterized by its unique structure that includes a cyclohexene ring and a butenyl substituent. This compound features a conjugated system due to the presence of the double bond in the butenyl group, which can influence its reactivity and stability. The presence of multiple methyl groups contributes to its hydrophobic nature and may affect its boiling point and solubility in various solvents. As a ketone, it contains a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. The compound's structure suggests potential applications in organic synthesis and as a flavor or fragrance component, given its cyclic and unsaturated nature. Additionally, its unique configuration may impart specific optical properties, making it of interest in materials science and photochemistry. Overall, this compound exemplifies the complexity and diversity of organic molecules in terms of structure and potential applications.
Formula:C13H20O
InChI:InChI=1S/C13H20O/c1-5-6-7-11-10(2)8-13(3,4)9-12(11)14/h5H,1,6-9H2,2-4H3
InChI key:InChIKey=PQSZUHFTXJYQMJ-UHFFFAOYSA-N
SMILES:C(CC=C)C1=C(C)CC(C)(C)CC1=O
Synonyms:- 2-Cyclohexen-1-one, 2-(3-butenyl)-3,5,5-trimethyl-
- 2-Cyclohexen-1-one, 2-(3-buten-1-yl)-3,5,5-trimethyl-
- 2-(3-Buten-1-yl)-3,5,5-trimethyl-2-cyclohexen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
