CymitQuimica logo

CAS 126571-48-0

:

Ethanone, 1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)- (9CI)

Description:
Ethanone, 1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)-, also known by its CAS number 126571-48-0, is a chemical compound characterized by its unique structure that includes a tetrahydropyrazolo[1,5-a]pyridine moiety. This compound features a ketone functional group (ethanone) attached to a nitrogen-containing heterocyclic ring, which contributes to its potential biological activity. The presence of the tetrahydropyrazole structure suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand for various biological targets. The compound is likely to be a solid or liquid at room temperature, with moderate solubility in organic solvents. Its molecular structure may impart specific reactivity patterns, making it of interest in medicinal chemistry and drug development. As with many nitrogen-containing heterocycles, it may also exhibit properties such as basicity and the ability to form hydrogen bonds, which can influence its interactions in biological systems. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-7(12)8-6-10-11-5-3-2-4-9(8)11/h6H,2-5H2,1H3
InChI key:PMTKHIBVGPJZPL-UHFFFAOYSA-N
SMILES:CC(=O)C1=C2CCCCN2N=C1
Found 2 products.