CAS 126582-18-1
:3-[4-(BENZYLOXY)PHENYL]-2-PHENYLACRYLIC ACID
Description:
3-[4-(Benzyloxy)phenyl]-2-phenylacrylic acid, with the CAS number 126582-18-1, is an organic compound characterized by its complex structure, which includes a phenylacrylic acid backbone substituted with a benzyloxy group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, contributing to its potential reactivity and solubility in organic solvents. The presence of the benzyloxy group enhances its lipophilicity, which may influence its biological activity and interaction with various biological targets. Additionally, the compound may display interesting optical properties due to its conjugated system, making it a candidate for applications in materials science and pharmaceuticals. Its structural features suggest potential uses in medicinal chemistry, particularly in the development of anti-inflammatory or anticancer agents, although specific biological activities would require empirical investigation. Overall, the compound's unique characteristics stem from its aromatic nature and functional groups, which play a crucial role in determining its chemical behavior and potential applications.
Formula:C22H18O3
InChI:InChI=1/C22H18O3/c23-22(24)21(19-9-5-2-6-10-19)15-17-11-13-20(14-12-17)25-16-18-7-3-1-4-8-18/h1-15H,16H2,(H,23,24)/b21-15+
Synonyms:- (2E)-3-[4-(benzyloxy)phenyl]-2-phenylprop-2-enoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
