CAS 126584-46-1
:N,N-dimethylpiperidin-3-amine dihydrochloride
Description:
N,N-Dimethylpiperidin-3-amine dihydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of two methyl groups attached to the nitrogen atom at the second position and an amino group at the third position contributes to its basicity and potential reactivity. As a dihydrochloride salt, it is typically more soluble in water, making it suitable for various applications in pharmaceutical and chemical research. This compound may exhibit properties such as being a potential ligand in coordination chemistry or serving as an intermediate in organic synthesis. Its molecular structure allows for interactions with biological systems, which may be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to its potential biological activity.
Formula:C7H18Cl2N2
InChI:InChI=1/C7H16N2.2ClH/c1-9(2)7-4-3-5-8-6-7;;/h7-8H,3-6H2,1-2H3;2*1H
SMILES:CN(C)C1CCCNC1.Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
