CAS 1265908-22-2

(4S)-2-(4-Hydroxy-3-methoxyphenyl)-4-thiazolidinecarboxylic acid

Description:

(4S)-2-(4-Hydroxy-3-methoxyphenyl)-4-thiazolidinecarboxylic acid is a chemical compound characterized by its thiazolidine ring structure, which incorporates a carboxylic acid functional group. The presence of a hydroxy group and a methoxy group on the aromatic ring contributes to its potential biological activity, possibly influencing its solubility and reactivity. The stereochemistry indicated by the (4S) designation suggests that the compound has specific spatial arrangements that may affect its interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the context of drug design and development, due to its structural features that could interact with various biological pathways. Additionally, the thiazolidine framework is often associated with compounds that have antioxidant or anti-inflammatory properties. Overall, this compound's unique structure and functional groups make it a subject of interest for further research in pharmacology and organic synthesis.

Formula: C₁₁H₁₃NO₄S

InChI: InChI=1S/C11H13NO4S/c1-16-9-4-6(2-3-8(9)13)10-12-7(5-17-10)11(14)15/h2-4,7,10,12-13H,5H2,1H3,(H,14,15)/t7-,10?/m1/s1

InChI key: InChIKey=JWNFSTNMEBJXKG-PVSHWOEXSA-N

SMILES: C(O)(=O)[C@@H]1NC(SC1)C2=CC(OC)=C(O)C=C2

Synonyms:

• 4-Thiazolidinecarboxylic acid, 2-(4-hydroxy-3-methoxyphenyl)-, (4S)-
• (4S)-2-(4-Hydroxy-3-methoxyphenyl)-4-thiazolidinecarboxylic acid